C14H21O5P — CID 141054477
2-diethoxyphosphoryl-2-(4-hydroxy-3,5-dimethylphenyl)acetaldehyde (PubChem CID 141054477) has the molecular formula C14H21O5P and a molecular weight of 300.29 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-2-(4-hydroxy-3,5-dimethylphenyl)acetaldehyde.
| Compound Name | 2-diethoxyphosphoryl-2-(4-hydroxy-3,5-dimethylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 141054477 |
| Molecular Formula | C14H21O5P |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-diethoxyphosphoryl-2-(4-hydroxy-3,5-dimethylphenyl)acetaldehyde |
| SMILES | CCOP(=O)(OCC)C(C=O)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C14H21O5P/c1-5-18-20(17,19-6-2)13(9-15)12-7-10(3)14(16)11(4)8-12/h7-9,13,16H,5-6H2,1-4H3 |
| InChIKey | OELHNLCBNSCHFY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|