C26H41N2O4P — CID 54354072
2,6-ditert-butyl-4-[di(propan-2-yloxy)phosphorylmethyl-pyridin-3-ylamino]phenol (PubChem CID 54354072) has the molecular formula C26H41N2O4P and a molecular weight of 476.60 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[di(propan-2-yloxy)phosphorylmethyl-pyridin-3-ylamino]phenol.
| Compound Name | 2,6-ditert-butyl-4-[di(propan-2-yloxy)phosphorylmethyl-pyridin-3-ylamino]phenol |
|---|---|
| PubChem CID | 54354072 |
| Molecular Formula | C26H41N2O4P |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 2,6-ditert-butyl-4-[di(propan-2-yloxy)phosphorylmethyl-pyridin-3-ylamino]phenol |
| SMILES | CC(C)OP(=O)(CN(c1cccnc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)OC(C)C |
| InChI | InChI=1S/C26H41N2O4P/c1-18(2)31-33(30,32-19(3)4)17-28(20-12-11-13-27-16-20)21-14-22(25(5,6)7)24(29)23(15-21)26(8,9)10/h11-16,18-19,29H,17H2,1-10H3 |
| InChIKey | UHVYOKWRTHNOTK-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|