C25H36NO2P — CID 10194500
2,6-ditert-butyl-4-[(Z)-1-diethylphosphoryl-2-pyridin-3-ylethenyl]phenol (PubChem CID 10194500) has the molecular formula C25H36NO2P and a molecular weight of 413.54 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(Z)-1-diethylphosphoryl-2-pyridin-3-ylethenyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(Z)-1-diethylphosphoryl-2-pyridin-3-ylethenyl]phenol |
|---|---|
| PubChem CID | 10194500 |
| Molecular Formula | C25H36NO2P |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 2,6-ditert-butyl-4-[(Z)-1-diethylphosphoryl-2-pyridin-3-ylethenyl]phenol |
| SMILES | CCP(=O)(CC)/C(=C\c1cccnc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H36NO2P/c1-9-29(28,10-2)22(14-18-12-11-13-26-17-18)19-15-20(24(3,4)5)23(27)21(16-19)25(6,7)8/h11-17,27H,9-10H2,1-8H3/b22-14- |
| InChIKey | RLXBYFHSDXZHSI-HMAPJEAMSA-N |
| XLogP | 7.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|