C11H18LiNO7PS — CID 86752306
CID 86752306 (PubChem CID 86752306) has the molecular formula C11H18LiNO7PS and a molecular weight of 346.25 g/mol.
| Compound Name | CID 86752306 |
|---|---|
| PubChem CID | 86752306 |
| Molecular Formula | C11H18LiNO7PS |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | — |
| SMILES | CCOP(=O)(OCC)C(O)(Cc1cccnc1)S(=O)(=O)O.[Li] |
| InChI | InChI=1S/C11H18NO7PS.Li/c1-3-18-20(14,19-4-2)11(13,21(15,16)17)8-10-6-5-7-12-9-10;/h5-7,9,13H,3-4,8H2,1-2H3,(H,15,16,17); |
| InChIKey | ICXRHKDFBMHYGZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|