C11H16NO4P — CID 18472741
2-[[benzyl(hydroxy)phosphoryl]amino]butanoic acid (PubChem CID 18472741) has the molecular formula C11H16NO4P and a molecular weight of 257.23 g/mol. Its IUPAC name is 2-[[benzyl(hydroxy)phosphoryl]amino]butanoic acid.
| Compound Name | 2-[[benzyl(hydroxy)phosphoryl]amino]butanoic acid |
|---|---|
| PubChem CID | 18472741 |
| Molecular Formula | C11H16NO4P |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[[benzyl(hydroxy)phosphoryl]amino]butanoic acid |
| SMILES | CCC(NP(=O)(O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H16NO4P/c1-2-10(11(13)14)12-17(15,16)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | ONFDYNIMZPDDPU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|