C19H24NO7P — CID 142639824
2-[[benzyl(hydroxy)phosphoryl]amino]-3-(2,3,4-trimethoxyphenyl)propanoic acid (PubChem CID 142639824) has the molecular formula C19H24NO7P and a molecular weight of 409.38 g/mol. Its IUPAC name is 2-[[benzyl(hydroxy)phosphoryl]amino]-3-(2,3,4-trimethoxyphenyl)propanoic acid.
| Compound Name | 2-[[benzyl(hydroxy)phosphoryl]amino]-3-(2,3,4-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 142639824 |
| Molecular Formula | C19H24NO7P |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[[benzyl(hydroxy)phosphoryl]amino]-3-(2,3,4-trimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(CC(NP(=O)(O)Cc2ccccc2)C(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C19H24NO7P/c1-25-16-10-9-14(17(26-2)18(16)27-3)11-15(19(21)22)20-28(23,24)12-13-7-5-4-6-8-13/h4-10,15H,11-12H2,1-3H3,(H,21,22)(H2,20,23,24) |
| InChIKey | ATUPYWHQSQEPEW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|