C16H18N2O — CID 166419454
(E)-1-(1,3-dihydroisoindol-2-yl)-4-[methyl(prop-2-ynyl)amino]but-2-en-1-one (PubChem CID 166419454) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is (E)-1-(1,3-dihydroisoindol-2-yl)-4-[methyl(prop-2-ynyl)amino]but-2-en-1-one.
| Compound Name | (E)-1-(1,3-dihydroisoindol-2-yl)-4-[methyl(prop-2-ynyl)amino]but-2-en-1-one |
|---|---|
| PubChem CID | 166419454 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (E)-1-(1,3-dihydroisoindol-2-yl)-4-[methyl(prop-2-ynyl)amino]but-2-en-1-one |
| SMILES | C#CCN(C)C/C=C/C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H18N2O/c1-3-10-17(2)11-6-9-16(19)18-12-14-7-4-5-8-15(14)13-18/h1,4-9H,10-13H2,2H3/b9-6+ |
| InChIKey | UIMJVGUHQRAHTC-RMKNXTFCSA-N |
| XLogP | 1.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|