C20H29N3O — CID 154872105
(E)-1-[4-(2,3-dihydroindol-1-ylmethyl)piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 154872105) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is (E)-1-[4-(2,3-dihydroindol-1-ylmethyl)piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | (E)-1-[4-(2,3-dihydroindol-1-ylmethyl)piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 154872105 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (E)-1-[4-(2,3-dihydroindol-1-ylmethyl)piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCC(CN2CCc3ccccc32)CC1 |
| InChI | InChI=1S/C20H29N3O/c1-21(2)12-5-8-20(24)22-13-9-17(10-14-22)16-23-15-11-18-6-3-4-7-19(18)23/h3-8,17H,9-16H2,1-2H3/b8-5+ |
| InChIKey | UAFNWFOWEWHODG-VMPITWQZSA-N |
| XLogP | 2.41 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|