C23H31N3O5 — CID 146590063
(2S)-2-[[(E)-7-(2,3-dihydroindol-1-yl)-6-methyl-1-oxohept-2-en-4-yl]carbamoyl]-1,4-oxazepane-4-carboxylic acid (PubChem CID 146590063) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2S)-2-[[(E)-7-(2,3-dihydroindol-1-yl)-6-methyl-1-oxohept-2-en-4-yl]carbamoyl]-1,4-oxazepane-4-carboxylic acid.
| Compound Name | (2S)-2-[[(E)-7-(2,3-dihydroindol-1-yl)-6-methyl-1-oxohept-2-en-4-yl]carbamoyl]-1,4-oxazepane-4-carboxylic acid |
|---|---|
| PubChem CID | 146590063 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (2S)-2-[[(E)-7-(2,3-dihydroindol-1-yl)-6-methyl-1-oxohept-2-en-4-yl]carbamoyl]-1,4-oxazepane-4-carboxylic acid |
| SMILES | CC(CC(/C=C/C=O)NC(=O)[C@@H]1CN(C(=O)O)CCCO1)CN1CCc2ccccc21 |
| InChI | InChI=1S/C23H31N3O5/c1-17(15-25-11-9-18-6-2-3-8-20(18)25)14-19(7-4-12-27)24-22(28)21-16-26(23(29)30)10-5-13-31-21/h2-4,6-8,12,17,19,21H,5,9-11,13-16H2,1H3,(H,24,28)(H,29,30)/b7-4+/t17?,19?,21-/m0/s1 |
| InChIKey | WDJKEDPCRUTVDK-CSNBVTGPSA-N |
| XLogP | 2.08 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|