C14H22N2O — CID 43165785
1-(2,3-dihydroindol-1-yl)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 43165785) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 43165785 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)CN1CCc2ccccc21 |
| InChI | InChI=1S/C14H22N2O/c1-11(2)15-9-13(17)10-16-8-7-12-5-3-4-6-14(12)16/h3-6,11,13,15,17H,7-10H2,1-2H3 |
| InChIKey | LVWGUWGQRKSOBP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |