C12H17N3 — CID 43367984
3-(2,3-dihydroindol-1-yl)-2-methylpropanimidamide (PubChem CID 43367984) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-2-methylpropanimidamide.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-2-methylpropanimidamide |
|---|---|
| PubChem CID | 43367984 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN1CCc2ccccc21 |
| InChI | InChI=1S/C12H17N3/c1-9(12(13)14)8-15-7-6-10-4-2-3-5-11(10)15/h2-5,9H,6-8H2,1H3,(H3,13,14) |
| InChIKey | GKZMALCALDBOKS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|