C12H14F3N3 — CID 103370547
2-(2,3-dihydroindol-1-ylmethyl)-3,3,3-trifluoropropanimidamide (PubChem CID 103370547) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-ylmethyl)-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-(2,3-dihydroindol-1-ylmethyl)-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370547 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(2,3-dihydroindol-1-ylmethyl)-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3/c13-12(14,15)9(11(16)17)7-18-6-5-8-3-1-2-4-10(8)18/h1-4,9H,5-7H2,(H3,16,17) |
| InChIKey | PVQABFUTXFFEIM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|