C10H11F3N2S — CID 103371378
3,3,3-trifluoro-2-(phenylsulfanylmethyl)propanimidamide (PubChem CID 103371378) has the molecular formula C10H11F3N2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(phenylsulfanylmethyl)propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-(phenylsulfanylmethyl)propanimidamide |
|---|---|
| PubChem CID | 103371378 |
| Molecular Formula | C10H11F3N2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3,3,3-trifluoro-2-(phenylsulfanylmethyl)propanimidamide |
| SMILES | [H]/N=C(\N)C(CSc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2S/c11-10(12,13)8(9(14)15)6-16-7-4-2-1-3-5-7/h1-5,8H,6H2,(H3,14,15) |
| InChIKey | QQUXYAYOFWCACJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|