C12H17F3N6 — CID 103370541
3,3,3-trifluoro-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]propanimidamide (PubChem CID 103370541) has the molecular formula C12H17F3N6 and a molecular weight of 302.30 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370541 |
| Molecular Formula | C12H17F3N6 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3,3,3-trifluoro-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CCN(c2ncccn2)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N6/c13-12(14,15)9(10(16)17)8-20-4-6-21(7-5-20)11-18-2-1-3-19-11/h1-3,9H,4-8H2,(H3,16,17) |
| InChIKey | GQSGIFPSPUKBHZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 82.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|