C17H29N5 — CID 12052820
(2R)-1-cyclohexyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-amine (PubChem CID 12052820) has the molecular formula C17H29N5 and a molecular weight of 303.45 g/mol. Its IUPAC name is (2R)-1-cyclohexyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-amine.
| Compound Name | (2R)-1-cyclohexyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 12052820 |
| Molecular Formula | C17H29N5 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | (2R)-1-cyclohexyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-amine |
| SMILES | N[C@H](CC1CCCCC1)CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H29N5/c18-16(13-15-5-2-1-3-6-15)14-21-9-11-22(12-10-21)17-19-7-4-8-20-17/h4,7-8,15-16H,1-3,5-6,9-14,18H2/t16-/m1/s1 |
| InChIKey | LTTMRIQCVZYJIG-MRXNPFEDSA-N |
| XLogP | 1.90 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |