C17H28N4O — CID 154754238
1-cyclopentyl-3-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)propan-2-ol (PubChem CID 154754238) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-cyclopentyl-3-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)propan-2-ol.
| Compound Name | 1-cyclopentyl-3-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 154754238 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 1-cyclopentyl-3-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)propan-2-ol |
| SMILES | OC(CC1CCCC1)CN1CCCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H28N4O/c22-16(13-15-5-1-2-6-15)14-20-9-4-10-21(12-11-20)17-18-7-3-8-19-17/h3,7-8,15-16,22H,1-2,4-6,9-14H2 |
| InChIKey | YDYAUZBZWHVNQQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |