About 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride
2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride (PubChem CID 46736988) has the molecular formula C10H19Cl2N5
and a molecular weight of 280.20 g/mol. Its IUPAC name is 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride |
| PubChem CID | 46736988 |
| Molecular Formula | C10H19Cl2N5 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C10H17N5.2ClH/c11-2-5-14-6-8-15(9-7-14)10-12-3-1-4-13-10;;/h1,3-4H,2,5-9,11H2;2*1H |
| InChIKey | ZITJIOAIBSBBFP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride?
The IUPAC name of 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride (CID 46736988) is 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride.
What is the SMILES notation for 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride?
The canonical SMILES for 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride is Cl.Cl.NCCN1CCN(c2ncccn2)CC1.
What is the InChIKey of 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride?
The InChIKey is ZITJIOAIBSBBFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5.2ClH/c11-2-5-14-6-8-15(9-7-14)10-12-3-1-4-13-10;;/h1,3-4H,2,5-9,11H2;2*1H.
What are the key properties of 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride?
2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride has a molecular weight of 280.20 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-pyrimidin-2-ylpiperazin-1-yl)ethanamine;dihydrochloride is sourced from PubChem (CID 46736988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).