C11H21F3N4 — CID 103370836
3,3,3-trifluoro-2-[(3,4,5-trimethylpiperazin-1-yl)methyl]propanimidamide (PubChem CID 103370836) has the molecular formula C11H21F3N4 and a molecular weight of 266.31 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3,4,5-trimethylpiperazin-1-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(3,4,5-trimethylpiperazin-1-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370836 |
| Molecular Formula | C11H21F3N4 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3,4,5-trimethylpiperazin-1-yl)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CC(C)N(C)C(C)C1)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N4/c1-7-4-18(5-8(2)17(7)3)6-9(10(15)16)11(12,13)14/h7-9H,4-6H2,1-3H3,(H3,15,16) |
| InChIKey | BAUFHPYOBXIMIW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|