C9H17F3N4 — CID 62967182
3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanimidamide (PubChem CID 62967182) has the molecular formula C9H17F3N4 and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanimidamide.
| Compound Name | 3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 62967182 |
| Molecular Formula | C9H17F3N4 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanimidamide |
| SMILES | [H]/N=C(\N)CCN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N4/c10-9(11,12)7-16-5-3-15(4-6-16)2-1-8(13)14/h1-7H2,(H3,13,14) |
| InChIKey | LSOSJPBHWKQVEN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|