C7H8ClF3N4 — CID 103370862
2-[(4-chloropyrazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103370862) has the molecular formula C7H8ClF3N4 and a molecular weight of 240.62 g/mol. Its IUPAC name is 2-[(4-chloropyrazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[(4-chloropyrazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370862 |
| Molecular Formula | C7H8ClF3N4 |
| Molecular Weight | 240.62 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-[(4-chloropyrazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(Cn1cc(Cl)cn1)C(F)(F)F |
| InChI | InChI=1S/C7H8ClF3N4/c8-4-1-14-15(2-4)3-5(6(12)13)7(9,10)11/h1-2,5H,3H2,(H3,12,13) |
| InChIKey | RWURFNPYOGWTAO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.62 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|