C17H22BrNO2 — CID 82258865
2-bromo-3-methyl-1-[1-(2-methylpropanoyl)-2,3-dihydroindol-5-yl]butan-1-one (PubChem CID 82258865) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 2-bromo-3-methyl-1-[1-(2-methylpropanoyl)-2,3-dihydroindol-5-yl]butan-1-one.
| Compound Name | 2-bromo-3-methyl-1-[1-(2-methylpropanoyl)-2,3-dihydroindol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 82258865 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-bromo-3-methyl-1-[1-(2-methylpropanoyl)-2,3-dihydroindol-5-yl]butan-1-one |
| SMILES | CC(C)C(=O)N1CCc2cc(C(=O)C(Br)C(C)C)ccc21 |
| InChI | InChI=1S/C17H22BrNO2/c1-10(2)15(18)16(20)13-5-6-14-12(9-13)7-8-19(14)17(21)11(3)4/h5-6,9-11,15H,7-8H2,1-4H3 |
| InChIKey | GBOLAJZBKNDSFA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|