C24H34BrNO2 — CID 82258873
2-bromo-1-[1-(4-butylcyclohexanecarbonyl)-2,3-dihydroindol-5-yl]-3-methylbutan-1-one (PubChem CID 82258873) has the molecular formula C24H34BrNO2 and a molecular weight of 448.45 g/mol. Its IUPAC name is 2-bromo-1-[1-(4-butylcyclohexanecarbonyl)-2,3-dihydroindol-5-yl]-3-methylbutan-1-one.
| Compound Name | 2-bromo-1-[1-(4-butylcyclohexanecarbonyl)-2,3-dihydroindol-5-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 82258873 |
| Molecular Formula | C24H34BrNO2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-bromo-1-[1-(4-butylcyclohexanecarbonyl)-2,3-dihydroindol-5-yl]-3-methylbutan-1-one |
| SMILES | CCCCC1CCC(C(=O)N2CCc3cc(C(=O)C(Br)C(C)C)ccc32)CC1 |
| InChI | InChI=1S/C24H34BrNO2/c1-4-5-6-17-7-9-18(10-8-17)24(28)26-14-13-19-15-20(11-12-21(19)26)23(27)22(25)16(2)3/h11-12,15-18,22H,4-10,13-14H2,1-3H3 |
| InChIKey | FBLAMGIEKUVEAY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|