C19H24ClNO2 — CID 82259087
2-chloro-1-[1-(cyclohexanecarbonyl)-2,3-dihydroindol-5-yl]butan-1-one (PubChem CID 82259087) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-chloro-1-[1-(cyclohexanecarbonyl)-2,3-dihydroindol-5-yl]butan-1-one.
| Compound Name | 2-chloro-1-[1-(cyclohexanecarbonyl)-2,3-dihydroindol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 82259087 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-chloro-1-[1-(cyclohexanecarbonyl)-2,3-dihydroindol-5-yl]butan-1-one |
| SMILES | CCC(Cl)C(=O)c1ccc2c(c1)CCN2C(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H24ClNO2/c1-2-16(20)18(22)15-8-9-17-14(12-15)10-11-21(17)19(23)13-6-4-3-5-7-13/h8-9,12-13,16H,2-7,10-11H2,1H3 |
| InChIKey | RZLBVGOFZDFGEG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|