C20H27NO3 — CID 82260166
5-[1-(cyclohexanecarbonyl)-2,3-dihydroindol-5-yl]pentanoic acid (PubChem CID 82260166) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 5-[1-(cyclohexanecarbonyl)-2,3-dihydroindol-5-yl]pentanoic acid.
| Compound Name | 5-[1-(cyclohexanecarbonyl)-2,3-dihydroindol-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 82260166 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 5-[1-(cyclohexanecarbonyl)-2,3-dihydroindol-5-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1ccc2c(c1)CCN2C(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H27NO3/c22-19(23)9-5-4-6-15-10-11-18-17(14-15)12-13-21(18)20(24)16-7-2-1-3-8-16/h10-11,14,16H,1-9,12-13H2,(H,22,23) |
| InChIKey | JJNMXSVAMLWUNE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|