C15H18BrNO — CID 82259205
[6-(2-bromoethyl)-3,4-dihydro-2H-quinolin-1-yl]-cyclopropylmethanone (PubChem CID 82259205) has the molecular formula C15H18BrNO and a molecular weight of 308.22 g/mol. Its IUPAC name is [6-(2-bromoethyl)-3,4-dihydro-2H-quinolin-1-yl]-cyclopropylmethanone.
| Compound Name | [6-(2-bromoethyl)-3,4-dihydro-2H-quinolin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 82259205 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | [6-(2-bromoethyl)-3,4-dihydro-2H-quinolin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCCc2cc(CCBr)ccc21 |
| InChI | InChI=1S/C15H18BrNO/c16-8-7-11-3-6-14-13(10-11)2-1-9-17(14)15(18)12-4-5-12/h3,6,10,12H,1-2,4-5,7-9H2 |
| InChIKey | CQRKUBRURPISSW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|