About [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone
[6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone (PubChem CID 82260079) has the molecular formula C24H38N2O
and a molecular weight of 370.58 g/mol. Its IUPAC name is [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone.
Molecular Properties
| Compound Name | [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone |
| PubChem CID | 82260079 |
| Molecular Formula | C24H38N2O |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone |
| SMILES | CCCCC1CCC(C(=O)N2CCCc3cc(CCCCN)ccc32)CC1 |
| InChI | InChI=1S/C24H38N2O/c1-2-3-7-19-10-13-21(14-11-19)24(27)26-17-6-9-22-18-20(8-4-5-16-25)12-15-23(22)26/h12,15,18-19,21H,2-11,13-14,16-17,25H2,1H3 |
| InChIKey | XKIBBQGSKZTAQO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone?
The IUPAC name of [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone (CID 82260079) is [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone.
What is the SMILES notation for [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone?
The canonical SMILES for [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone is CCCCC1CCC(C(=O)N2CCCc3cc(CCCCN)ccc32)CC1.
What is the InChIKey of [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone?
The InChIKey is XKIBBQGSKZTAQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H38N2O/c1-2-3-7-19-10-13-21(14-11-19)24(27)26-17-6-9-22-18-20(8-4-5-16-25)12-15-23(22)26/h12,15,18-19,21H,2-11,13-14,16-17,25H2,1H3.
What are the key properties of [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone?
[6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone has a molecular weight of 370.58 g/mol, XLogP of 5.24, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone is sourced from PubChem (CID 82260079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).