C24H38N2O — CID 82260079
[6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone (PubChem CID 82260079) has the molecular formula C24H38N2O and a molecular weight of 370.58 g/mol. Its IUPAC name is [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone.
| Compound Name | [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone |
|---|---|
| PubChem CID | 82260079 |
| Molecular Formula | C24H38N2O |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | [6-(4-aminobutyl)-3,4-dihydro-2H-quinolin-1-yl]-(4-butylcyclohexyl)methanone |
| SMILES | CCCCC1CCC(C(=O)N2CCCc3cc(CCCCN)ccc32)CC1 |
| InChI | InChI=1S/C24H38N2O/c1-2-3-7-19-10-13-21(14-11-19)24(27)26-17-6-9-22-18-20(8-4-5-16-25)12-15-23(22)26/h12,15,18-19,21H,2-11,13-14,16-17,25H2,1H3 |
| InChIKey | XKIBBQGSKZTAQO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|