C23H32ClNO2 — CID 82259134
1-[1-(4-butylcyclohexanecarbonyl)-2,3-dihydroindol-5-yl]-4-chlorobutan-1-one (PubChem CID 82259134) has the molecular formula C23H32ClNO2 and a molecular weight of 389.97 g/mol. Its IUPAC name is 1-[1-(4-butylcyclohexanecarbonyl)-2,3-dihydroindol-5-yl]-4-chlorobutan-1-one.
| Compound Name | 1-[1-(4-butylcyclohexanecarbonyl)-2,3-dihydroindol-5-yl]-4-chlorobutan-1-one |
|---|---|
| PubChem CID | 82259134 |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-[1-(4-butylcyclohexanecarbonyl)-2,3-dihydroindol-5-yl]-4-chlorobutan-1-one |
| SMILES | CCCCC1CCC(C(=O)N2CCc3cc(C(=O)CCCCl)ccc32)CC1 |
| InChI | InChI=1S/C23H32ClNO2/c1-2-3-5-17-7-9-18(10-8-17)23(27)25-15-13-19-16-20(11-12-21(19)25)22(26)6-4-14-24/h11-12,16-18H,2-10,13-15H2,1H3 |
| InChIKey | CDZNDZNYCLZXLX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|