C14H13ClF3NO2 — CID 95412014
4-chloro-1-[1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]butan-1-one (PubChem CID 95412014) has the molecular formula C14H13ClF3NO2 and a molecular weight of 319.71 g/mol. Its IUPAC name is 4-chloro-1-[1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]butan-1-one.
| Compound Name | 4-chloro-1-[1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 95412014 |
| Molecular Formula | C14H13ClF3NO2 |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-chloro-1-[1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]butan-1-one |
| SMILES | O=C(CCCCl)c1ccc2c(c1)CCN2C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3NO2/c15-6-1-2-12(20)10-3-4-11-9(8-10)5-7-19(11)13(21)14(16,17)18/h3-4,8H,1-2,5-7H2 |
| InChIKey | QLLIEZMZMMJSJT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|