C14H16ClNO2 — CID 28803845
1-[5-(2-chloroacetyl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one (PubChem CID 28803845) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 1-[5-(2-chloroacetyl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[5-(2-chloroacetyl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 28803845 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-[5-(2-chloroacetyl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCc2cc(C(=O)CCl)ccc21 |
| InChI | InChI=1S/C14H16ClNO2/c1-9(2)14(18)16-6-5-10-7-11(13(17)8-15)3-4-12(10)16/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | NRKMWBIAVPZFJQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|