C25H38BrNO — CID 82259504
[5-(2-bromo-4-methylpentyl)-2,3-dihydroindol-1-yl]-(4-butylcyclohexyl)methanone (PubChem CID 82259504) has the molecular formula C25H38BrNO and a molecular weight of 448.49 g/mol. Its IUPAC name is [5-(2-bromo-4-methylpentyl)-2,3-dihydroindol-1-yl]-(4-butylcyclohexyl)methanone.
| Compound Name | [5-(2-bromo-4-methylpentyl)-2,3-dihydroindol-1-yl]-(4-butylcyclohexyl)methanone |
|---|---|
| PubChem CID | 82259504 |
| Molecular Formula | C25H38BrNO |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | [5-(2-bromo-4-methylpentyl)-2,3-dihydroindol-1-yl]-(4-butylcyclohexyl)methanone |
| SMILES | CCCCC1CCC(C(=O)N2CCc3cc(CC(Br)CC(C)C)ccc32)CC1 |
| InChI | InChI=1S/C25H38BrNO/c1-4-5-6-19-7-10-21(11-8-19)25(28)27-14-13-22-16-20(9-12-24(22)27)17-23(26)15-18(2)3/h9,12,16,18-19,21,23H,4-8,10-11,13-15,17H2,1-3H3 |
| InChIKey | WLWWDKSPTAHFBC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|