C23H33NO3 — CID 82260180
5-[1-(3-cyclohexylpropanoyl)-2-methyl-2,3-dihydroindol-5-yl]pentanoic acid (PubChem CID 82260180) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 5-[1-(3-cyclohexylpropanoyl)-2-methyl-2,3-dihydroindol-5-yl]pentanoic acid.
| Compound Name | 5-[1-(3-cyclohexylpropanoyl)-2-methyl-2,3-dihydroindol-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 82260180 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 5-[1-(3-cyclohexylpropanoyl)-2-methyl-2,3-dihydroindol-5-yl]pentanoic acid |
| SMILES | CC1Cc2cc(CCCCC(=O)O)ccc2N1C(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C23H33NO3/c1-17-15-20-16-19(9-5-6-10-23(26)27)11-13-21(20)24(17)22(25)14-12-18-7-3-2-4-8-18/h11,13,16-18H,2-10,12,14-15H2,1H3,(H,26,27) |
| InChIKey | RPUUQUFCJGCIMH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|