C17H26N2O — CID 43550092
1-(5-amino-2-methyl-2,3-dihydroindol-1-yl)octan-1-one (PubChem CID 43550092) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-(5-amino-2-methyl-2,3-dihydroindol-1-yl)octan-1-one.
| Compound Name | 1-(5-amino-2-methyl-2,3-dihydroindol-1-yl)octan-1-one |
|---|---|
| PubChem CID | 43550092 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-(5-amino-2-methyl-2,3-dihydroindol-1-yl)octan-1-one |
| SMILES | CCCCCCCC(=O)N1c2ccc(N)cc2CC1C |
| InChI | InChI=1S/C17H26N2O/c1-3-4-5-6-7-8-17(20)19-13(2)11-14-12-15(18)9-10-16(14)19/h9-10,12-13H,3-8,11,18H2,1-2H3 |
| InChIKey | XMASAQBNEDGZRK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|