C10H13N3O — CID 43551503
5-amino-2-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 43551503) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-amino-2-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-amino-2-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 43551503 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 5-amino-2-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CC1Cc2cc(N)ccc2N1C(N)=O |
| InChI | InChI=1S/C10H13N3O/c1-6-4-7-5-8(11)2-3-9(7)13(6)10(12)14/h2-3,5-6H,4,11H2,1H3,(H2,12,14) |
| InChIKey | VVTNHPZMJVNRJE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|