C16H14Br2N2O — CID 114367699
(5-amino-2-methyl-2,3-dihydroindol-1-yl)-(2,5-dibromophenyl)methanone (PubChem CID 114367699) has the molecular formula C16H14Br2N2O and a molecular weight of 410.11 g/mol. Its IUPAC name is (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(2,5-dibromophenyl)methanone.
| Compound Name | (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(2,5-dibromophenyl)methanone |
|---|---|
| PubChem CID | 114367699 |
| Molecular Formula | C16H14Br2N2O |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(2,5-dibromophenyl)methanone |
| SMILES | CC1Cc2cc(N)ccc2N1C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H14Br2N2O/c1-9-6-10-7-12(19)3-5-15(10)20(9)16(21)13-8-11(17)2-4-14(13)18/h2-5,7-9H,6,19H2,1H3 |
| InChIKey | UXTQOCVCACUFRI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|