C15H18N4O — CID 43550098
(5-amino-2-methyl-2,3-dihydroindol-1-yl)-(1,5-dimethylpyrazol-4-yl)methanone (PubChem CID 43550098) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(1,5-dimethylpyrazol-4-yl)methanone.
| Compound Name | (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(1,5-dimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 43550098 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(1,5-dimethylpyrazol-4-yl)methanone |
| SMILES | Cc1c(C(=O)N2c3ccc(N)cc3CC2C)cnn1C |
| InChI | InChI=1S/C15H18N4O/c1-9-6-11-7-12(16)4-5-14(11)19(9)15(20)13-8-17-18(3)10(13)2/h4-5,7-9H,6,16H2,1-3H3 |
| InChIKey | NFVYZXBGJPTEMO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|