C16H23N3O — CID 79152708
(5-amino-2-methyl-2,3-dihydroindol-1-yl)-(azepan-1-yl)methanone (PubChem CID 79152708) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(azepan-1-yl)methanone.
| Compound Name | (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(azepan-1-yl)methanone |
|---|---|
| PubChem CID | 79152708 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (5-amino-2-methyl-2,3-dihydroindol-1-yl)-(azepan-1-yl)methanone |
| SMILES | CC1Cc2cc(N)ccc2N1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C16H23N3O/c1-12-10-13-11-14(17)6-7-15(13)19(12)16(20)18-8-4-2-3-5-9-18/h6-7,11-12H,2-5,8-10,17H2,1H3 |
| InChIKey | YNPILVPKHMFUJV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|