C16H21NO3 — CID 82350336
methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate (PubChem CID 82350336) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate.
| Compound Name | methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate |
|---|---|
| PubChem CID | 82350336 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate |
| SMILES | COC(=O)CCCc1ccc2c(c1)CC(C)N2C(C)=O |
| InChI | InChI=1S/C16H21NO3/c1-11-9-14-10-13(5-4-6-16(19)20-3)7-8-15(14)17(11)12(2)18/h7-8,10-11H,4-6,9H2,1-3H3 |
| InChIKey | LCMVMQKWOFKRBV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |