methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate

C16H21NO3 — CID 82350336

IUPACmethyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate
SMILESCOC(=O)CCCc1ccc2c(c1)CC(C)N2C(C)=O
InChIInChI=1S/C16H21NO3/c1-11-9-14-10-13(5-4-6-16(19)20-3)7-8-15(14)17(11)12(2)18/h7-8,10-11H,4-6,9H2,1-3H3
InChIKeyLCMVMQKWOFKRBV-UHFFFAOYSA-N
MW275.35 g/mol
LogP2.48
Rot. Bonds4

About methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate

methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate (PubChem CID 82350336) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate.

Molecular Properties

Compound Namemethyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate
PubChem CID82350336
Molecular FormulaC16H21NO3
Molecular Weight275.35 g/mol
Exact Mass275.15
IUPAC Namemethyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate
SMILESCOC(=O)CCCc1ccc2c(c1)CC(C)N2C(C)=O
InChIInChI=1S/C16H21NO3/c1-11-9-14-10-13(5-4-6-16(19)20-3)7-8-15(14)17(11)12(2)18/h7-8,10-11H,4-6,9H2,1-3H3
InChIKeyLCMVMQKWOFKRBV-UHFFFAOYSA-N
XLogP2.48
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.35
LogP ≤ 52.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate?
The IUPAC name of methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate (CID 82350336) is methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate.
What is the SMILES notation for methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate?
The canonical SMILES for methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate is COC(=O)CCCc1ccc2c(c1)CC(C)N2C(C)=O.
What is the InChIKey of methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate?
The InChIKey is LCMVMQKWOFKRBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3/c1-11-9-14-10-13(5-4-6-16(19)20-3)7-8-15(14)17(11)12(2)18/h7-8,10-11H,4-6,9H2,1-3H3.
What are the key properties of methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate?
methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate has a molecular weight of 275.35 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1-acetyl-2-methyl-2,3-dihydroindol-5-yl)butanoate is sourced from PubChem (CID 82350336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).