C13H13ClF3NO — CID 82260529
1-[5-(2-chloroethyl)-2-methyl-2,3-dihydroindol-1-yl]-2,2,2-trifluoroethanone (PubChem CID 82260529) has the molecular formula C13H13ClF3NO and a molecular weight of 291.70 g/mol. Its IUPAC name is 1-[5-(2-chloroethyl)-2-methyl-2,3-dihydroindol-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-(2-chloroethyl)-2-methyl-2,3-dihydroindol-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 82260529 |
| Molecular Formula | C13H13ClF3NO |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-[5-(2-chloroethyl)-2-methyl-2,3-dihydroindol-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1Cc2cc(CCCl)ccc2N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H13ClF3NO/c1-8-6-10-7-9(4-5-14)2-3-11(10)18(8)12(19)13(15,16)17/h2-3,7-8H,4-6H2,1H3 |
| InChIKey | RJYKROKIGYWLPG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|