C14H13BrF3NO2 — CID 82258686
2-bromo-1-[2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]propan-1-one (PubChem CID 82258686) has the molecular formula C14H13BrF3NO2 and a molecular weight of 364.16 g/mol. Its IUPAC name is 2-bromo-1-[2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]propan-1-one.
| Compound Name | 2-bromo-1-[2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 82258686 |
| Molecular Formula | C14H13BrF3NO2 |
| Molecular Weight | 364.16 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 2-bromo-1-[2-methyl-1-(2,2,2-trifluoroacetyl)-2,3-dihydroindol-5-yl]propan-1-one |
| SMILES | CC(Br)C(=O)c1ccc2c(c1)CC(C)N2C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13BrF3NO2/c1-7-5-10-6-9(12(20)8(2)15)3-4-11(10)19(7)13(21)14(16,17)18/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | MSJIYVGWHCUZAN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|