C18H24BrNO2 — CID 82258955
1-[5-(2-bromo-2-methylpropanoyl)-2-methyl-2,3-dihydroindol-1-yl]-3-methylbutan-1-one (PubChem CID 82258955) has the molecular formula C18H24BrNO2 and a molecular weight of 366.30 g/mol. Its IUPAC name is 1-[5-(2-bromo-2-methylpropanoyl)-2-methyl-2,3-dihydroindol-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[5-(2-bromo-2-methylpropanoyl)-2-methyl-2,3-dihydroindol-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 82258955 |
| Molecular Formula | C18H24BrNO2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[5-(2-bromo-2-methylpropanoyl)-2-methyl-2,3-dihydroindol-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1c2ccc(C(=O)C(C)(C)Br)cc2CC1C |
| InChI | InChI=1S/C18H24BrNO2/c1-11(2)8-16(21)20-12(3)9-14-10-13(6-7-15(14)20)17(22)18(4,5)19/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | KDWGKBDNCKJSQJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|