C19H28BrNO — CID 82259583
1-[5-(2-bromo-2-methylpropyl)-2-methyl-2,3-dihydroindol-1-yl]-2-ethylbutan-1-one (PubChem CID 82259583) has the molecular formula C19H28BrNO and a molecular weight of 366.34 g/mol. Its IUPAC name is 1-[5-(2-bromo-2-methylpropyl)-2-methyl-2,3-dihydroindol-1-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[5-(2-bromo-2-methylpropyl)-2-methyl-2,3-dihydroindol-1-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 82259583 |
| Molecular Formula | C19H28BrNO |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[5-(2-bromo-2-methylpropyl)-2-methyl-2,3-dihydroindol-1-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1c2ccc(CC(C)(C)Br)cc2CC1C |
| InChI | InChI=1S/C19H28BrNO/c1-6-15(7-2)18(22)21-13(3)10-16-11-14(8-9-17(16)21)12-19(4,5)20/h8-9,11,13,15H,6-7,10,12H2,1-5H3 |
| InChIKey | GSDKKOOZKQVHSX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|