C20H28BrNO — CID 82259316
[5-(2-bromobutyl)-2-methyl-2,3-dihydroindol-1-yl]-cyclohexylmethanone (PubChem CID 82259316) has the molecular formula C20H28BrNO and a molecular weight of 378.35 g/mol. Its IUPAC name is [5-(2-bromobutyl)-2-methyl-2,3-dihydroindol-1-yl]-cyclohexylmethanone.
| Compound Name | [5-(2-bromobutyl)-2-methyl-2,3-dihydroindol-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 82259316 |
| Molecular Formula | C20H28BrNO |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [5-(2-bromobutyl)-2-methyl-2,3-dihydroindol-1-yl]-cyclohexylmethanone |
| SMILES | CCC(Br)Cc1ccc2c(c1)CC(C)N2C(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H28BrNO/c1-3-18(21)13-15-9-10-19-17(12-15)11-14(2)22(19)20(23)16-7-5-4-6-8-16/h9-10,12,14,16,18H,3-8,11,13H2,1-2H3 |
| InChIKey | WFUZVZYRIVARCK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|