C15H15FN4O — CID 103502364
(6-fluoro-2,3-dihydroindol-1-yl)-(4-hydrazinyl-6-methyl-3-pyridinyl)methanone (PubChem CID 103502364) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is (6-fluoro-2,3-dihydroindol-1-yl)-(4-hydrazinyl-6-methyl-3-pyridinyl)methanone.
| Compound Name | (6-fluoro-2,3-dihydroindol-1-yl)-(4-hydrazinyl-6-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 103502364 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (6-fluoro-2,3-dihydroindol-1-yl)-(4-hydrazinyl-6-methyl-3-pyridinyl)methanone |
| SMILES | Cc1cc(NN)c(C(=O)N2CCc3ccc(F)cc32)cn1 |
| InChI | InChI=1S/C15H15FN4O/c1-9-6-13(19-17)12(8-18-9)15(21)20-5-4-10-2-3-11(16)7-14(10)20/h2-3,6-8H,4-5,17H2,1H3,(H,18,19) |
| InChIKey | ARWGFTCXXDVGPZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|