C17H16ClNOS — CID 107030694
(2-chloro-5-sulfanylphenyl)-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)methanone (PubChem CID 107030694) has the molecular formula C17H16ClNOS and a molecular weight of 317.84 g/mol. Its IUPAC name is (2-chloro-5-sulfanylphenyl)-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)methanone.
| Compound Name | (2-chloro-5-sulfanylphenyl)-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)methanone |
|---|---|
| PubChem CID | 107030694 |
| Molecular Formula | C17H16ClNOS |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2-chloro-5-sulfanylphenyl)-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)methanone |
| SMILES | O=C(c1cc(S)ccc1Cl)N1CCc2ccccc2CC1 |
| InChI | InChI=1S/C17H16ClNOS/c18-16-6-5-14(21)11-15(16)17(20)19-9-7-12-3-1-2-4-13(12)8-10-19/h1-6,11,21H,7-10H2 |
| InChIKey | FQAVDZHFKUOSEO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|