C13H13N3OS — CID 65199933
(5-amino-2,3-dihydroindol-1-yl)-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 65199933) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is (5-amino-2,3-dihydroindol-1-yl)-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | (5-amino-2,3-dihydroindol-1-yl)-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 65199933 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (5-amino-2,3-dihydroindol-1-yl)-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CCc3cc(N)ccc32)cs1 |
| InChI | InChI=1S/C13H13N3OS/c1-8-15-11(7-18-8)13(17)16-5-4-9-6-10(14)2-3-12(9)16/h2-3,6-7H,4-5,14H2,1H3 |
| InChIKey | MLFIOWXEPQWYBV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|