About (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone
(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone (PubChem CID 99716081) has the molecular formula C19H17N3OS
and a molecular weight of 335.43 g/mol. Its IUPAC name is (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 99716081 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)c1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C19H17N3OS/c1-13-4-5-17-15(11-13)3-2-10-22(17)19(23)16-12-24-18(21-16)14-6-8-20-9-7-14/h4-9,11-12H,2-3,10H2,1H3 |
| InChIKey | BPJNELAESWKEQS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone?
The IUPAC name of (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone (CID 99716081) is (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone is Cc1ccc2c(c1)CCCN2C(=O)c1csc(-c2ccncc2)n1.
What is the InChIKey of (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone?
The InChIKey is BPJNELAESWKEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3OS/c1-13-4-5-17-15(11-13)3-2-10-22(17)19(23)16-12-24-18(21-16)14-6-8-20-9-7-14/h4-9,11-12H,2-3,10H2,1H3.
What are the key properties of (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone?
(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone has a molecular weight of 335.43 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(2-pyridin-4-yl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 99716081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).