C23H25N3O2 — CID 110634451
1-phenyl-4-(5-pyrrolidin-1-yl-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one (PubChem CID 110634451) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-phenyl-4-(5-pyrrolidin-1-yl-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-phenyl-4-(5-pyrrolidin-1-yl-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 110634451 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-phenyl-4-(5-pyrrolidin-1-yl-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCc3cc(N4CCCC4)ccc32)CN1c1ccccc1 |
| InChI | InChI=1S/C23H25N3O2/c27-22-15-18(16-26(22)19-6-2-1-3-7-19)23(28)25-13-10-17-14-20(8-9-21(17)25)24-11-4-5-12-24/h1-3,6-9,14,18H,4-5,10-13,15-16H2 |
| InChIKey | WQXVFIBYOACPKS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|