C24H28N4O3 — CID 123603655
1-(3-aminophenyl)-4-[5-(morpholin-4-ylmethyl)-2,3-dihydroindole-1-carbonyl]pyrrolidin-2-one (PubChem CID 123603655) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-(3-aminophenyl)-4-[5-(morpholin-4-ylmethyl)-2,3-dihydroindole-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3-aminophenyl)-4-[5-(morpholin-4-ylmethyl)-2,3-dihydroindole-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123603655 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-(3-aminophenyl)-4-[5-(morpholin-4-ylmethyl)-2,3-dihydroindole-1-carbonyl]pyrrolidin-2-one |
| SMILES | Nc1cccc(N2CC(C(=O)N3CCc4cc(CN5CCOCC5)ccc43)CC2=O)c1 |
| InChI | InChI=1S/C24H28N4O3/c25-20-2-1-3-21(14-20)28-16-19(13-23(28)29)24(30)27-7-6-18-12-17(4-5-22(18)27)15-26-8-10-31-11-9-26/h1-5,12,14,19H,6-11,13,15-16,25H2 |
| InChIKey | RANDMRMSSGWLOH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|