C18H22N2O2S2 — CID 110315939
1-(5-ethylthiophen-2-yl)sulfonyl-6-pyrrolidin-1-yl-2,3-dihydroindole (PubChem CID 110315939) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-6-pyrrolidin-1-yl-2,3-dihydroindole.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-6-pyrrolidin-1-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 110315939 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-6-pyrrolidin-1-yl-2,3-dihydroindole |
| SMILES | CCc1ccc(S(=O)(=O)N2CCc3ccc(N4CCCC4)cc32)s1 |
| InChI | InChI=1S/C18H22N2O2S2/c1-2-16-7-8-18(23-16)24(21,22)20-12-9-14-5-6-15(13-17(14)20)19-10-3-4-11-19/h5-8,13H,2-4,9-12H2,1H3 |
| InChIKey | KPAZMCMOECYDIS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |