C16H18N2O2S2 — CID 110316037
5-pyrrolidin-1-yl-1-thiophen-2-ylsulfonyl-2,3-dihydroindole (PubChem CID 110316037) has the molecular formula C16H18N2O2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 5-pyrrolidin-1-yl-1-thiophen-2-ylsulfonyl-2,3-dihydroindole.
| Compound Name | 5-pyrrolidin-1-yl-1-thiophen-2-ylsulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 110316037 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 5-pyrrolidin-1-yl-1-thiophen-2-ylsulfonyl-2,3-dihydroindole |
| SMILES | O=S(=O)(c1cccs1)N1CCc2cc(N3CCCC3)ccc21 |
| InChI | InChI=1S/C16H18N2O2S2/c19-22(20,16-4-3-11-21-16)18-10-7-13-12-14(5-6-15(13)18)17-8-1-2-9-17/h3-6,11-12H,1-2,7-10H2 |
| InChIKey | TXDBBTXRIOODPU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|